2-Methoxy pinselin
| Internal ID | 652e5204-d9b9-42c2-9d0e-5a503dca6fbb |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | methyl 8-hydroxy-2-methoxy-6-methyl-9-oxoxanthene-1-carboxylate |
| SMILES (Canonical) | CC1=CC(=C2C(=C1)OC3=C(C2=O)C(=C(C=C3)OC)C(=O)OC)O |
| SMILES (Isomeric) | CC1=CC(=C2C(=C1)OC3=C(C2=O)C(=C(C=C3)OC)C(=O)OC)O |
| InChI | InChI=1S/C17H14O6/c1-8-6-9(18)13-12(7-8)23-11-5-4-10(21-2)15(17(20)22-3)14(11)16(13)19/h4-7,18H,1-3H3 |
| InChI Key | AHQKWUAFVNUPBZ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 82.10 Ų |
| XlogP | 3.30 |
| CHEBI:215682 |
| methyl 8-hydroxy-2-methoxy-6-methyl-9-oxoxanthene-1-carboxylate |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.25% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.31% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.57% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.73% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.19% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.95% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.41% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.98% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.80% | 94.73% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 87.44% | 93.65% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.97% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.44% | 99.17% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.24% | 91.49% |
| CHEMBL5979 | P05186 | Alkaline phosphatase, tissue-nonspecific isozyme | 83.75% | 85.40% |
| CHEMBL3194 | P02766 | Transthyretin | 82.41% | 90.71% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.96% | 90.71% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 80.43% | 90.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11709424 |
| LOTUS | LTS0068299 |
| wikiData | Q103816124 |