2-methoxy-5-[(E)-2-phenylethenyl]phenol
| Internal ID | dd94b111-8514-4864-b8f5-a5de31b5daa1 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 2-methoxy-5-[(E)-2-phenylethenyl]phenol |
| SMILES (Canonical) | COC1=C(C=C(C=C1)C=CC2=CC=CC=C2)O |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)/C=C/C2=CC=CC=C2)O |
| InChI | InChI=1S/C15H14O2/c1-17-15-10-9-13(11-14(15)16)8-7-12-5-3-2-4-6-12/h2-11,16H,1H3/b8-7+ |
| InChI Key | QVPJESIABXRENB-BQYQJAHWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.099379685 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 3.80 |
| SCHEMBL5496427 |
![2D Structure of 2-methoxy-5-[(E)-2-phenylethenyl]phenol](https://plantaedb.com/storage/docs/compounds/2023/11/2-methoxy-5-e-2-phenylethenylphenol.jpg "2D Structure of 2-methoxy-5-[(E)-2-phenylethenyl]phenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.46% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.34% | 91.11% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.55% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.73% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.95% | 91.49% |
| CHEMBL3194 | P02766 | Transthyretin | 91.34% | 90.71% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.15% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.15% | 96.09% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.14% | 90.20% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.03% | 95.50% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.63% | 94.62% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.55% | 98.75% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 83.45% | 94.08% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.04% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.85% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.45% | 90.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.04% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cryptocarya idenburgensis |
| PubChem | 6529462 |
| LOTUS | LTS0139273 |
| wikiData | Q105228818 |