2-Methoxy-5-(7-methoxy-2H-1,3-benzodioxol-5-yl)phenol
| Internal ID | 413fe7dc-02d7-4b87-9a9b-964311f64ed4 |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | 2-methoxy-5-(7-methoxy-1,3-benzodioxol-5-yl)phenol |
| SMILES (Canonical) | COC1=C(C=C(C=C1)C2=CC3=C(C(=C2)OC)OCO3)O |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)C2=CC3=C(C(=C2)OC)OCO3)O |
| InChI | InChI=1S/C15H14O5/c1-17-12-4-3-9(5-11(12)16)10-6-13(18-2)15-14(7-10)19-8-20-15/h3-7,16H,8H2,1-2H3 |
| InChI Key | VONRCGMJFIHOPV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08412354 g/mol |
| Topological Polar Surface Area (TPSA) | 57.20 Ų |
| XlogP | 2.90 |
| 2-Methoxy-5-(7-methoxy-2H-1,3-benzodioxol-5-yl)phenol |
| DTXSID50771859 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.75% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.48% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.17% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.67% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.55% | 86.33% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 90.19% | 88.48% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.95% | 96.77% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 89.95% | 82.67% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.29% | 98.95% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.01% | 92.62% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 85.85% | 80.96% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.27% | 95.56% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.18% | 95.78% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.33% | 92.94% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.33% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.76% | 99.15% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.23% | 95.89% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.15% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Monnina salicifolia |
| Monnina sylvatica |
| PubChem | 71345592 |
| LOTUS | LTS0071691 |
| wikiData | Q82731951 |