2-Methoxy-5-[2-(3-methoxyphenyl)ethyl]phenol
| Internal ID | 0a02f333-1bab-46b5-9466-b4dd6fba7fef |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 2-methoxy-5-[2-(3-methoxyphenyl)ethyl]phenol |
| SMILES (Canonical) | COC1=C(C=C(C=C1)CCC2=CC(=CC=C2)OC)O |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)CCC2=CC(=CC=C2)OC)O |
| InChI | InChI=1S/C16H18O3/c1-18-14-5-3-4-12(10-14)6-7-13-8-9-16(19-2)15(17)11-13/h3-5,8-11,17H,6-7H2,1-2H3 |
| InChI Key | JSSBUTWUGVPHQT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.125594432 g/mol |
| Topological Polar Surface Area (TPSA) | 38.70 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.95% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.49% | 98.95% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 93.01% | 90.20% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.60% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.01% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.07% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.65% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.80% | 91.11% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.05% | 86.92% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.68% | 99.17% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 88.39% | 96.09% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.31% | 95.50% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.99% | 93.99% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.94% | 95.89% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.35% | 90.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.20% | 96.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.18% | 99.15% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.57% | 94.73% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.16% | 90.24% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 83.09% | 99.18% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.35% | 94.45% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.35% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 85896575 |
| LOTUS | LTS0132409 |
| wikiData | Q105134545 |