(2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate
Internal ID | 3ad091f7-afc5-4412-8ac2-4d06eb092d33 |
Taxonomy | Benzenoids > Phenol esters |
IUPAC Name | (2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate |
SMILES (Canonical) | CCC(C)C(=O)OC1=C(C=C(C=C1)CC=C)OC |
SMILES (Isomeric) | CC[C@@H](C)C(=O)OC1=C(C=C(C=C1)CC=C)OC |
InChI | InChI=1S/C15H20O3/c1-5-7-12-8-9-13(14(10-12)17-4)18-15(16)11(3)6-2/h5,8-11H,1,6-7H2,2-4H3/t11-/m1/s1 |
InChI Key | SGAQPQHTGWRULN-LLVKDONJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H20O3 |
Molecular Weight | 248.32 g/mol |
Exact Mass | 248.14124450 g/mol |
Topological Polar Surface Area (TPSA) | 35.50 Ų |
XlogP | 4.10 |
There are no found synonyms. |
![2D Structure of (2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate 2D Structure of (2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/2-methoxy-4-prop-2-enylphenyl-2r-2-methylbutanoate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.16% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.36% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.52% | 94.45% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 91.26% | 90.20% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.85% | 99.17% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.00% | 95.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.63% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 85.36% | 98.75% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.00% | 96.95% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.57% | 89.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.53% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.41% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.22% | 90.00% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.02% | 90.24% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.47% | 92.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.01% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aster indicus |
PubChem | 93483199 |
LOTUS | LTS0211017 |
wikiData | Q105252194 |