2-Methoxy-4-hydroxydihydrochalcone
| Internal ID | 07810b9f-0d08-4c58-beee-71c7c16506dc |
| Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > Retro-dihydrochalcones |
| IUPAC Name | 3-(4-hydroxy-2-methoxyphenyl)-1-phenylpropan-1-one |
| SMILES (Canonical) | COC1=C(C=CC(=C1)O)CCC(=O)C2=CC=CC=C2 |
| SMILES (Isomeric) | COC1=C(C=CC(=C1)O)CCC(=O)C2=CC=CC=C2 |
| InChI | InChI=1S/C16H16O3/c1-19-16-11-14(17)9-7-13(16)8-10-15(18)12-5-3-2-4-6-12/h2-7,9,11,17H,8,10H2,1H3 |
| InChI Key | RWDXOTXVACHAOX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.109944368 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 3.10 |
| 3-(4-hydroxy-2-methoxyphenyl)-1-phenylpropan-1-one |
| RefChem:87829 |
| 196863-37-3 |
| SCHEMBL7198317 |
| CHEBI:137729 |
| LMPK12120605 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.18% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.41% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 94.10% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.97% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.68% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.84% | 95.56% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.79% | 90.20% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.72% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.10% | 90.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.74% | 95.50% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.48% | 96.95% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.28% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dracaena cinnabari |
| PubChem | 42607734 |
| LOTUS | LTS0076430 |
| wikiData | Q105246472 |