2-methoxy-4-[(E)-2-[(2S)-pyrrolidin-2-yl]ethenyl]phenol
| Internal ID | d492b961-9191-4711-b5f3-73daaa5a3122 |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | 2-methoxy-4-[(E)-2-[(2S)-pyrrolidin-2-yl]ethenyl]phenol |
| SMILES (Canonical) | COC1=C(C=CC(=C1)C=CC2CCCN2)O |
| SMILES (Isomeric) | COC1=C(C=CC(=C1)/C=C/[C@@H]2CCCN2)O |
| InChI | InChI=1S/C13H17NO2/c1-16-13-9-10(5-7-12(13)15)4-6-11-3-2-8-14-11/h4-7,9,11,14-15H,2-3,8H2,1H3/b6-4+/t11-/m0/s1 |
| InChI Key | SINQQIYBRFZEIU-MALLOTDXSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.125928785 g/mol |
| Topological Polar Surface Area (TPSA) | 41.50 Ų |
| XlogP | 2.20 |
| There are no found synonyms. |
![2D Structure of 2-methoxy-4-[(E)-2-[(2S)-pyrrolidin-2-yl]ethenyl]phenol](https://plantaedb.com/storage/docs/compounds/2023/11/2-methoxy-4-e-2-2s-pyrrolidin-2-ylethenylphenol.jpg "2D Structure of 2-methoxy-4-[(E)-2-[(2S)-pyrrolidin-2-yl]ethenyl]phenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.98% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.92% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.69% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.03% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.87% | 94.45% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.12% | 89.62% |
| CHEMBL3194 | P02766 | Transthyretin | 90.63% | 90.71% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.35% | 91.49% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.25% | 96.00% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 88.51% | 88.48% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.46% | 86.33% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.83% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.94% | 95.89% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.88% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.58% | 89.00% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 82.41% | 95.56% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.97% | 92.62% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.00% | 98.75% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.24% | 91.03% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 80.23% | 92.68% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ficus septica |
| PubChem | 102586110 |
| LOTUS | LTS0069632 |
| wikiData | Q105253880 |