2-Methoxy-4-(7-methoxy-3-methyl-5-prop-1-enyl-1-benzofuran-2-yl)phenol
| Internal ID | ab863ab8-801c-410a-b317-279cb5f5cbb9 |
| Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
| IUPAC Name | 2-methoxy-4-(7-methoxy-3-methyl-5-prop-1-enyl-1-benzofuran-2-yl)phenol |
| SMILES (Canonical) | CC=CC1=CC2=C(C(=C1)OC)OC(=C2C)C3=CC(=C(C=C3)O)OC |
| SMILES (Isomeric) | CC=CC1=CC2=C(C(=C1)OC)OC(=C2C)C3=CC(=C(C=C3)O)OC |
| InChI | InChI=1S/C20H20O4/c1-5-6-13-9-15-12(2)19(24-20(15)18(10-13)23-4)14-7-8-16(21)17(11-14)22-3/h5-11,21H,1-4H3 |
| InChI Key | FMRNCDXSOOJISX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.13615911 g/mol |
| Topological Polar Surface Area (TPSA) | 51.80 Ų |
| XlogP | 4.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.95% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.82% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.42% | 89.00% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 92.86% | 98.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.91% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.66% | 96.00% |
| CHEMBL3194 | P02766 | Transthyretin | 89.95% | 90.71% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.90% | 91.49% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.86% | 94.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.33% | 97.21% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 88.67% | 98.35% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.53% | 99.15% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.37% | 94.73% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.29% | 93.31% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.28% | 92.94% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 82.17% | 88.48% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.69% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.65% | 95.89% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.24% | 91.71% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 80.02% | 95.48% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Magnolia kachirachirai |
| Piper ribesioides |
| Senna lindheimeriana |
| PubChem | 71437692 |
| LOTUS | LTS0169237 |
| wikiData | Q104997998 |