2-Methoxy-4-[1,2,3-tris(2-methoxy-4-prop-2-enylphenoxy)propyl]phenol
Internal ID | b3dc75cf-67ec-4c91-b14f-0bf3a4065b0f |
Taxonomy | Benzenoids > Phenols > Methoxyphenols |
IUPAC Name | 2-methoxy-4-[1,2,3-tris(2-methoxy-4-prop-2-enylphenoxy)propyl]phenol |
SMILES (Canonical) | COC1=C(C=CC(=C1)CC=C)OCC(C(C2=CC(=C(C=C2)O)OC)OC3=C(C=C(C=C3)CC=C)OC)OC4=C(C=C(C=C4)CC=C)OC |
SMILES (Isomeric) | COC1=C(C=CC(=C1)CC=C)OCC(C(C2=CC(=C(C=C2)O)OC)OC3=C(C=C(C=C3)CC=C)OC)OC4=C(C=C(C=C4)CC=C)OC |
InChI | InChI=1S/C40H44O8/c1-8-11-27-14-19-32(36(22-27)43-5)46-26-39(47-33-20-15-28(12-9-2)23-37(33)44-6)40(30-17-18-31(41)35(25-30)42-4)48-34-21-16-29(13-10-3)24-38(34)45-7/h8-10,14-25,39-41H,1-3,11-13,26H2,4-7H3 |
InChI Key | FEUZDFRCUJDPQF-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C40H44O8 |
Molecular Weight | 652.80 g/mol |
Exact Mass | 652.30361836 g/mol |
Topological Polar Surface Area (TPSA) | 84.80 Ų |
XlogP | 9.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.11% | 96.09% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 97.30% | 95.17% |
CHEMBL2581 | P07339 | Cathepsin D | 93.75% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.53% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.44% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.34% | 90.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.70% | 91.11% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 91.56% | 90.24% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.43% | 89.62% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.36% | 94.45% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 87.65% | 90.20% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.63% | 95.89% |
CHEMBL2535 | P11166 | Glucose transporter | 86.50% | 98.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.81% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.77% | 99.15% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.79% | 95.50% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.55% | 93.40% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.45% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.23% | 91.49% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.88% | 97.21% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.66% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ocimum tenuiflorum |
PubChem | 25231266 |
LOTUS | LTS0103127 |
wikiData | Q104994211 |