2-methoxy-3-methyl-9H-carbazole
Internal ID | b5cab20d-84e1-4928-928c-8e013de545c9 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | 2-methoxy-3-methyl-9H-carbazole |
SMILES (Canonical) | CC1=CC2=C(C=C1OC)NC3=CC=CC=C32 |
SMILES (Isomeric) | CC1=CC2=C(C=C1OC)NC3=CC=CC=C32 |
InChI | InChI=1S/C14H13NO/c1-9-7-11-10-5-3-4-6-12(10)15-13(11)8-14(9)16-2/h3-8,15H,1-2H3 |
InChI Key | XYYYPIAQQFQTAN-UHFFFAOYSA-N |
Popularity | 10 references in papers |
Molecular Formula | C14H13NO |
Molecular Weight | 211.26 g/mol |
Exact Mass | 211.099714038 g/mol |
Topological Polar Surface Area (TPSA) | 25.00 Ų |
XlogP | 3.70 |
2-methoxy-3-methylcarbazole |
24224-28-0 |
9H-Carbazole, 2-methoxy-3-methyl- |
MLS000863588 |
MEGxp0_001489 |
SCHEMBL4143973 |
CHEMBL1501672 |
ACon1_002035 |
CHEBI:125206 |
DTXSID901310471 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.71% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.67% | 91.11% |
CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 93.16% | 98.21% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.10% | 93.99% |
CHEMBL2535 | P11166 | Glucose transporter | 91.50% | 98.75% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 88.16% | 85.49% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 88.11% | 92.98% |
CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 87.13% | 95.70% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.48% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.17% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.80% | 86.33% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 83.55% | 94.23% |
CHEMBL1907 | P15144 | Aminopeptidase N | 83.22% | 93.31% |
CHEMBL2581 | P07339 | Cathepsin D | 82.90% | 98.95% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 82.79% | 89.44% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.69% | 94.62% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.42% | 96.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.05% | 94.75% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 82.01% | 92.67% |
CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 81.64% | 85.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 81.61% | 94.08% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.96% | 85.14% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 80.18% | 90.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Glycosmis macrophylla |
PubChem | 11052947 |
LOTUS | LTS0210101 |
wikiData | Q27215553 |