2-Methoxy-[1,3]benzodioxolo[5,6-c]phenanthridin-1-ol
| Internal ID | 3b6b6b23-2d15-4b99-9185-f87fa4cdc37c |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Phenanthridines and derivatives |
| IUPAC Name | 2-methoxy-[1,3]benzodioxolo[5,6-c]phenanthridin-1-ol |
| SMILES (Canonical) | COC1=C(C2=CN=C3C(=C2C=C1)C=CC4=CC5=C(C=C43)OCO5)O |
| SMILES (Isomeric) | COC1=C(C2=CN=C3C(=C2C=C1)C=CC4=CC5=C(C=C43)OCO5)O |
| InChI | InChI=1S/C19H13NO4/c1-22-15-5-4-11-12-3-2-10-6-16-17(24-9-23-16)7-13(10)18(12)20-8-14(11)19(15)21/h2-8,21H,9H2,1H3 |
| InChI Key | FRSOYBXQJMIDQW-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H13NO4 |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.08445790 g/mol |
| Topological Polar Surface Area (TPSA) | 60.80 Ų |
| XlogP | 4.10 |
| There are no found synonyms. |
![2D Structure of 2-Methoxy-[1,3]benzodioxolo[5,6-c]phenanthridin-1-ol](https://plantaedb.com/storage/docs/compounds/2023/11/2-methoxy-13benzodioxolo56-cphenanthridin-1-ol.jpg "2D Structure of 2-Methoxy-[1,3]benzodioxolo[5,6-c]phenanthridin-1-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.62% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.74% | 91.49% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.73% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.17% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.70% | 86.33% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.11% | 92.62% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.74% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.34% | 99.17% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 89.13% | 85.30% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.67% | 95.78% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.04% | 96.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.40% | 96.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.86% | 95.89% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 85.57% | 85.49% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.50% | 97.36% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.42% | 96.77% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.25% | 89.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.25% | 94.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.18% | 90.00% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.11% | 97.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.91% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.81% | 95.56% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 83.60% | 92.50% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.04% | 92.94% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.44% | 94.42% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.25% | 99.23% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.25% | 89.62% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.59% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zanthoxylum integrifoliolum |
| PubChem | 135844948 |
| LOTUS | LTS0167340 |
| wikiData | Q105000406 |