2-Methoxy-1-(2-methylpropoxy)-4-[1-(2-methylpropoxy)prop-2-enyl]benzene
Internal ID | 1b3a87c1-043e-4c62-846f-58e132aaabd7 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzylethers |
IUPAC Name | 2-methoxy-1-(2-methylpropoxy)-4-[1-(2-methylpropoxy)prop-2-enyl]benzene |
SMILES (Canonical) | CC(C)COC1=C(C=C(C=C1)C(C=C)OCC(C)C)OC |
SMILES (Isomeric) | CC(C)COC1=C(C=C(C=C1)C(C=C)OCC(C)C)OC |
InChI | InChI=1S/C18H28O3/c1-7-16(20-11-13(2)3)15-8-9-17(18(10-15)19-6)21-12-14(4)5/h7-10,13-14,16H,1,11-12H2,2-6H3 |
InChI Key | IWUPZPJBWFXWOI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H28O3 |
Molecular Weight | 292.40 g/mol |
Exact Mass | 292.20384475 g/mol |
Topological Polar Surface Area (TPSA) | 27.70 Ų |
XlogP | 5.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.67% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.73% | 96.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.22% | 90.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.78% | 89.62% |
CHEMBL2581 | P07339 | Cathepsin D | 90.45% | 98.95% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 89.46% | 90.24% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.72% | 86.33% |
CHEMBL1907 | P15144 | Aminopeptidase N | 88.44% | 93.31% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.92% | 99.17% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 87.25% | 90.20% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.93% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.10% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 84.51% | 98.75% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 82.95% | 92.98% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.35% | 94.73% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.23% | 100.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.05% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bidens rubifolia |
Coreopsis grandiflora |
Coreopsis venusta |
PubChem | 163014963 |
LOTUS | LTS0136122 |
wikiData | Q105121890 |