2-Isopropyl-4,8-dimethylazulene
| Internal ID | c54d7d38-f9f2-43b3-8b49-ee5b45155ac7 |
| Taxonomy | Hydrocarbons > Unsaturated hydrocarbons > Olefins > Cyclic olefins > Azulenes |
| IUPAC Name | 4,8-dimethyl-2-propan-2-ylazulene |
| SMILES (Canonical) | CC1=C2C=C(C=C2C(=CC=C1)C)C(C)C |
| SMILES (Isomeric) | CC1=C2C=C(C=C2C(=CC=C1)C)C(C)C |
| InChI | InChI=1S/C15H18/c1-10(2)13-8-14-11(3)6-5-7-12(4)15(14)9-13/h5-10H,1-4H3 |
| InChI Key | APVKGMMYGFJZHY-UHFFFAOYSA-N |
| Popularity | 49 references in papers |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.30 g/mol |
| Exact Mass | 198.140850574 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 4.80 |
| 2-Isopropyl-4,8-dimethylazulene |
| 529-08-8 |
| 5DFF5RUP6X |
| EINECS 208-450-1 |
| UNII-5DFF5RUP6X |
| DTXSID80200940 |
| APVKGMMYGFJZHY-UHFFFAOYSA-N |
| AZULENE, 2-ISOPROPYL-4,8-DIMETHYL- |
| Azulene, 4,8-dimethyl-2-(1-methylethyl)- |
| Q2862043 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.42% | 98.95% |
| CHEMBL260 | Q16539 | MAP kinase p38 alpha | 93.21% | 97.78% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 93.02% | 93.31% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.55% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.14% | 95.56% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 89.89% | 97.23% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 88.24% | 93.65% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.61% | 98.75% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.99% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.45% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.40% | 96.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 85.26% | 90.24% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.08% | 93.56% |
| CHEMBL4422 | O14842 | Free fatty acid receptor 1 | 83.55% | 93.33% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 82.90% | 83.14% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.83% | 93.40% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.16% | 100.00% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 81.07% | 81.29% |
| CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 80.04% | 96.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lepidozia vitrea |
| PubChem | 68253 |
| LOTUS | LTS0082266 |
| wikiData | Q2862043 |