2-Imino-7-oxidopurin-7-ium-6-one
| Internal ID | fca7cc89-aa3e-4248-98d8-ffea704f68d4 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Alpha-imino acid and derivatives |
| IUPAC Name | 2-imino-7-oxidopurin-7-ium-6-one |
| SMILES (Canonical) | C1=NC2=NC(=N)NC(=O)C2=[N+]1[O-] |
| SMILES (Isomeric) | C1=NC2=NC(=N)NC(=O)C2=[N+]1[O-] |
| InChI | InChI=1S/C5H3N5O2/c6-5-8-3-2(4(11)9-5)10(12)1-7-3/h1H,(H2,6,9,11) |
| InChI Key | ZOTSKNKNZKCBRH-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C5H3N5O2 |
| Molecular Weight | 165.11 g/mol |
| Exact Mass | 165.02867436 g/mol |
| Topological Polar Surface Area (TPSA) | 106.00 Ų |
| XlogP | -1.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 91.30% | 88.84% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.64% | 89.63% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.20% | 95.56% |
| CHEMBL4578 | Q14680 | Maternal embryonic leucine zipper kinase | 82.00% | 81.58% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.83% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.41% | 94.45% |
| CHEMBL262 | P49841 | Glycogen synthase kinase-3 beta | 81.37% | 95.72% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 141548779 |
| LOTUS | LTS0115301 |
| wikiData | Q105380711 |