2-Quinolone-3-carboxylic acid
| Internal ID | 127c6027-19d1-4a64-b88f-a1763f80ee8b |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinoline carboxylic acids |
| IUPAC Name | 2-oxo-1H-quinoline-3-carboxylic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H7NO3/c12-9-7(10(13)14)5-6-3-1-2-4-8(6)11-9/h1-5H,(H,11,12)(H,13,14) |
| InChI Key | XOQQVKDBGLYPGH-UHFFFAOYSA-N |
| Popularity | 253 references in papers |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.042593085 g/mol |
| Topological Polar Surface Area (TPSA) | 66.40 Ų |
| XlogP | 1.60 |
| 2-hydroxyquinoline-3-carboxylic acid |
| 2-Oxo-1,2-dihydro-quinoline-3-carboxylic acid |
| 2-oxo-1H-quinoline-3-carboxylic acid |
| 2-oxo-1,2-dihydro-3-quinolinecarboxylic acid |
| 2-oxo-1,2-dihydroquinoline-3-carboxylic acid |
| 2-Hydroxy-3-quinolinecarboxylic acid |
| 3-Quinolinecarboxylic acid, 1,2-dihydro-2-oxo- |
| 2-quinolone-3-carboxylic acid |
| 5YC1Y02JDC |
| NSC329342 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.15% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.11% | 98.75% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.75% | 93.03% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 87.60% | 87.67% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 87.34% | 94.62% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.32% | 91.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.35% | 99.23% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.68% | 93.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.53% | 98.95% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.10% | 91.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.95% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 332488 |
| LOTUS | LTS0210127 |
| wikiData | Q83043888 |