2-(Hydroxymethyl)-6-[(4-methyl-1-propan-2-yl-3-bicyclo[3.1.0]hexanyl)oxy]oxane-3,4,5-triol
| Internal ID | ba10e376-bef1-40c7-9316-8dc1c5750cdd |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
| IUPAC Name | 2-(hydroxymethyl)-6-[(4-methyl-1-propan-2-yl-3-bicyclo[3.1.0]hexanyl)oxy]oxane-3,4,5-triol |
| SMILES (Canonical) | CC1C2CC2(CC1OC3C(C(C(C(O3)CO)O)O)O)C(C)C |
| SMILES (Isomeric) | CC1C2CC2(CC1OC3C(C(C(C(O3)CO)O)O)O)C(C)C |
| InChI | InChI=1S/C16H28O6/c1-7(2)16-4-9(16)8(3)10(5-16)21-15-14(20)13(19)12(18)11(6-17)22-15/h7-15,17-20H,4-6H2,1-3H3 |
| InChI Key | IAMFEXMKGWXBDC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.18858861 g/mol |
| Topological Polar Surface Area (TPSA) | 99.40 Ų |
| XlogP | 1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.40% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.38% | 91.11% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 94.11% | 95.93% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.07% | 97.25% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 92.74% | 97.79% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 90.26% | 96.61% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.26% | 97.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.80% | 85.14% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.41% | 96.21% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.31% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.21% | 90.17% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.96% | 96.47% |
| CHEMBL3589 | P55263 | Adenosine kinase | 80.93% | 98.05% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.01% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artemisia gmelinii |
| PubChem | 162843620 |
| LOTUS | LTS0067838 |
| wikiData | Q105036189 |