2-Hydroxyglutaric acid
| Internal ID | 93022748-7b6e-47b4-8d24-5f43c7bbc4fd |
| Taxonomy | Organic acids and derivatives > Hydroxy acids and derivatives > Short-chain hydroxy acids and derivatives |
| IUPAC Name | 2-hydroxypentanedioic acid |
| SMILES (Canonical) | C(CC(=O)O)C(C(=O)O)O |
| SMILES (Isomeric) | C(CC(=O)O)C(C(=O)O)O |
| InChI | InChI=1S/C5H8O5/c6-3(5(9)10)1-2-4(7)8/h3,6H,1-2H2,(H,7,8)(H,9,10) |
| InChI Key | HWXBTNAVRSUOJR-UHFFFAOYSA-N |
| Popularity | 937 references in papers |
| Molecular Formula | C5H8O5 |
| Molecular Weight | 148.11 g/mol |
| Exact Mass | 148.03717335 g/mol |
| Topological Polar Surface Area (TPSA) | 94.80 Ų |
| XlogP | -1.00 |
| 2-hydroxypentanedioic acid |
| 2889-31-8 |
| 2-hydroxyglutarate |
| alpha-hydroxyglutarate |
| alpha-Hydroxyglutaric acid |
| Pentanedioic acid, 2-hydroxy- |
| 2,3-Dideoxypentaric acid |
| 2-oxidanylpentanedioic acid |
| Glutaric acid, 2-hydroxy- |
| RS4M3UYS95 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.15% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.42% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.13% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.63% | 99.17% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.06% | 83.82% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 83.26% | 92.26% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 81.15% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arabidopsis thaliana |
| Euphorbia resinifera |
| PubChem | 43 |
| LOTUS | LTS0187001 |
| wikiData | Q209412 |