2-hydroxy-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide
Internal ID | 7ebb8097-bc50-4aaf-b595-6a07476526a2 |
Taxonomy | Hydrocarbon derivatives > Tropones |
IUPAC Name | 2-hydroxy-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
SMILES (Canonical) | COC1=CC=C2C(=CC1=O)C(CCC3=CC(=C(C(=C32)OC)OC)OC)NC(=O)CO |
SMILES (Isomeric) | COC1=CC=C2C(=CC1=O)[C@H](CCC3=CC(=C(C(=C32)OC)OC)OC)NC(=O)CO |
InChI | InChI=1S/C22H25NO7/c1-27-17-8-6-13-14(10-16(17)25)15(23-19(26)11-24)7-5-12-9-18(28-2)21(29-3)22(30-4)20(12)13/h6,8-10,15,24H,5,7,11H2,1-4H3,(H,23,26)/t15-/m0/s1 |
InChI Key | DIELAJDYLJKYSH-HNNXBMFYSA-N |
Popularity | 3 references in papers |
Molecular Formula | C22H25NO7 |
Molecular Weight | 415.40 g/mol |
Exact Mass | 415.16310214 g/mol |
Topological Polar Surface Area (TPSA) | 103.00 Ų |
XlogP | 0.40 |
DTXSID701317821 |
![2D Structure of 2-hydroxy-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide 2D Structure of 2-hydroxy-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide](https://plantaedb.com/storage/docs/compounds/2023/11/2-hydroxy-n-7s-12310-tetramethoxy-9-oxo-67-dihydro-5h-benzoaheptalen-7-ylacetamide.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.38% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.57% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.30% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.09% | 99.17% |
CHEMBL2535 | P11166 | Glucose transporter | 91.89% | 98.75% |
CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 91.66% | 96.33% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.23% | 90.71% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 89.54% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.25% | 85.14% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.63% | 95.89% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.72% | 93.03% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.12% | 92.62% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 84.91% | 92.38% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 83.47% | 95.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.99% | 95.89% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 82.34% | 96.76% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.96% | 96.38% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.62% | 95.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.60% | 91.19% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.01% | 89.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.55% | 89.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.33% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.14% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Colchicum turcicum |
PubChem | 14781534 |
LOTUS | LTS0189803 |
wikiData | Q104981201 |