2-hydroxy-N-[(2R)-1-hydroxypropan-2-yl]benzamide
| Internal ID | bbed646c-06fa-4c8a-81fc-cff0bf6b9bfe |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Salicylic acid and derivatives > Salicylamides |
| IUPAC Name | 2-hydroxy-N-[(2R)-1-hydroxypropan-2-yl]benzamide |
| SMILES (Canonical) | CC(CO)NC(=O)C1=CC=CC=C1O |
| SMILES (Isomeric) | C[C@H](CO)NC(=O)C1=CC=CC=C1O |
| InChI | InChI=1S/C10H13NO3/c1-7(6-12)11-10(14)8-4-2-3-5-9(8)13/h2-5,7,12-13H,6H2,1H3,(H,11,14)/t7-/m1/s1 |
| InChI Key | ATSKSNBYTZUJRU-SSDOTTSWSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.08954328 g/mol |
| Topological Polar Surface Area (TPSA) | 69.60 Ų |
| XlogP | 1.10 |
| 2-hydroxy-N-[(2R)-1-hydroxypropan-2-yl]benzamide |
| CHEMBL4063531 |
| EBC-12255 |
| AKOS017578627 |
| (R)-(-)-N-salicyloyl-2-aminopropan-1-ol |
| EN300-5096882 |
![2D Structure of 2-hydroxy-N-[(2R)-1-hydroxypropan-2-yl]benzamide](https://plantaedb.com/storage/docs/compounds/2023/11/2-hydroxy-n-2r-1-hydroxypropan-2-ylbenzamide.jpg "2D Structure of 2-hydroxy-N-[(2R)-1-hydroxypropan-2-yl]benzamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.95% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.53% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.16% | 91.11% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 90.05% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.86% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.68% | 96.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.69% | 93.56% |
| CHEMBL2321614 | Q9NPC2 | Potassium channel subfamily K member 9 | 83.45% | 80.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.61% | 98.75% |
| CHEMBL3308 | P55212 | Caspase-6 | 81.67% | 97.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.87% | 90.17% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.80% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 79030909 |
| LOTUS | LTS0075829 |
| wikiData | Q104918648 |