2-Hydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-8-one
| Internal ID | 62e1824e-3b5e-484f-9348-c2ebcd19a862 |
| Taxonomy | Alkaloids and derivatives > Lupin alkaloids > Sparteine, lupanine, and related alkaloids |
| IUPAC Name | 2-hydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-8-one |
| SMILES (Canonical) | C1CCN2CC3CC(C2C1)C(=O)N4C3(CCCC4)O |
| SMILES (Isomeric) | C1CCN2CC3CC(C2C1)C(=O)N4C3(CCCC4)O |
| InChI | InChI=1S/C15H24N2O2/c18-14-12-9-11(10-16-7-3-1-5-13(12)16)15(19)6-2-4-8-17(14)15/h11-13,19H,1-10H2 |
| InChI Key | JQZWYIGAWHLKBY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.183778013 g/mol |
| Topological Polar Surface Area (TPSA) | 43.80 Ų |
| XlogP | 0.90 |
| There are no found synonyms. |
![2D Structure of 2-Hydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-8-one](https://plantaedb.com/storage/docs/compounds/2023/11/2-hydroxy-715-diazatetracyclo77102701015heptadecan-8-one.jpg "2D Structure of 2-Hydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-8-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.79% | 97.25% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 91.61% | 93.03% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 90.82% | 93.04% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.72% | 97.09% |
| CHEMBL238 | Q01959 | Dopamine transporter | 90.67% | 95.88% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 89.91% | 99.29% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.09% | 98.95% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 88.21% | 96.03% |
| CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 88.13% | 97.98% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.78% | 95.50% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.36% | 82.69% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.36% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.97% | 96.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.57% | 90.71% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.56% | 93.00% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 83.30% | 94.78% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.99% | 94.45% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 82.63% | 98.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.08% | 95.89% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 80.89% | 91.76% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.72% | 92.94% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.62% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Virgilia divaricata |
| PubChem | 12310663 |
| LOTUS | LTS0231131 |
| wikiData | Q104254148 |