2-Hydroxy4,7-dimethoxy-9,10-dihydrophenanthrene
| Internal ID | d47ff13e-2aed-4b99-8ec9-59b77fc6b935 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
| IUPAC Name | 4,7-dimethoxy-9,10-dihydrophenanthren-2-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H16O3/c1-18-13-5-6-14-10(8-13)3-4-11-7-12(17)9-15(19-2)16(11)14/h5-9,17H,3-4H2,1-2H3 |
| InChI Key | HWILQAUQOIOQMW-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.109944368 g/mol |
| Topological Polar Surface Area (TPSA) | 38.70 Ų |
| XlogP | 3.40 |
| 2-Hydroxy4,7-dimethoxy-9,10-dihydrophenanthrene |
| 2-Phenanthrenol, 9,10-dihydro-4,7-dimethoxy- |
| 2-hydroxy-4,7-dimethoxy-9,10-dihydrophenanthrene |
| CHEMBL254600 |
| orb1941388 |
| SCHEMBL23203411 |
| 2-hydroxy-4,7-dimethoxyphenanthrene |
| HY-N10882 |
| DA-60138 |
| CS-0637316 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.35% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.86% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.97% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 94.83% | 90.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.64% | 96.09% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 92.69% | 98.35% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.69% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.16% | 98.95% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 89.68% | 91.79% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 89.34% | 91.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.90% | 94.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 86.72% | 93.31% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.36% | 99.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.19% | 95.89% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.03% | 98.75% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.00% | 95.89% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 81.75% | 95.93% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.11% | 99.15% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.08% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dendrobium nobile |
| PubChem | 24762426 |
| NPASS | NPC170485 |
| ChEMBL | CHEMBL254600 |
| LOTUS | LTS0263105 |
| wikiData | Q105034668 |