2-Hydroxy-4-phenylphenalen-1-one
| Internal ID | 72f405b5-39aa-4b50-921c-507443b6b551 |
| Taxonomy | Benzenoids > Naphthalenes > Phenylnaphthalenes |
| IUPAC Name | 2-hydroxy-4-phenylphenalen-1-one |
| SMILES (Canonical) | C1=CC=C(C=C1)C2=C3C=C(C(=O)C4=CC=CC(=C43)C=C2)O |
| SMILES (Isomeric) | C1=CC=C(C=C1)C2=C3C=C(C(=O)C4=CC=CC(=C43)C=C2)O |
| InChI | InChI=1S/C19H12O2/c20-17-11-16-14(12-5-2-1-3-6-12)10-9-13-7-4-8-15(18(13)16)19(17)21/h1-11,20H |
| InChI Key | WQFZXPBMLGMQBO-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C19H12O2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.083729621 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 4.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.48% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.79% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.53% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.48% | 91.11% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 92.48% | 96.09% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 90.73% | 96.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.47% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.58% | 99.23% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.09% | 95.50% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.93% | 90.17% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.71% | 94.75% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.58% | 82.69% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 80.57% | 90.20% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 80.48% | 96.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.06% | 93.56% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 80.05% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Musa acuminata |
| PubChem | 46906667 |
| LOTUS | LTS0245850 |
| wikiData | Q105310695 |