2-hydroxy-4-(4-methoxyphenyl)-1H-phenalen-1-one
| Internal ID | 5d79d685-0b69-4c42-8878-91d4713f5c89 |
| Taxonomy | Benzenoids > Naphthalenes > Phenylnaphthalenes |
| IUPAC Name | 2-hydroxy-4-(4-methoxyphenyl)phenalen-1-one |
| SMILES (Canonical) | COC1=CC=C(C=C1)C2=C3C=C(C(=O)C4=CC=CC(=C43)C=C2)O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)C2=C3C=C(C(=O)C4=CC=CC(=C43)C=C2)O |
| InChI | InChI=1S/C20H14O3/c1-23-14-8-5-12(6-9-14)15-10-7-13-3-2-4-16-19(13)17(15)11-18(21)20(16)22/h2-11,21H,1H3 |
| InChI Key | PVZKBQMWQRUUFI-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H14O3 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.094294304 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 4.60 |
| 159853-36-8 |
| 2-hydroxy-4-(4-methoxyphenyl)-1H-phenalen-1-one |
| 2-hydroxy-4-(4-methoxyphenyl)phenalen-1-one |
| 1H-phenalen-1-one, 2-hydroxy-4-(4-methoxyphenyl)- |
| DTXSID10348561 |
| AKOS032949146 |
| 2-hydroxy-4-(4'-methoxyphenyl)-1h-phenalen-1-one |
| InChI=1/C20H14O3/c1-23-14-8-5-12(6-9-14)15-10-7-13-3-2-4-16-19(13)17(15)11-18(21)20(16)22/h2-11,21H,1H |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.52% | 98.95% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 96.80% | 93.31% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.65% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.63% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.87% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.25% | 94.00% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 94.07% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.73% | 86.33% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 90.56% | 96.67% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.95% | 99.15% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.37% | 98.75% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.61% | 82.69% |
| CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 86.20% | 91.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.66% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.46% | 99.23% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.78% | 95.50% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.11% | 86.92% |
| CHEMBL1944 | P08473 | Neprilysin | 81.13% | 92.63% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 80.86% | 91.00% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.79% | 91.71% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.25% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Musa acuminata |
| Musa balbisiana |
| PubChem | 638391 |
| LOTUS | LTS0168023 |
| wikiData | Q82123499 |