2-Hydroxy-2,3-dihydrogenistein
| Internal ID | f41fb056-1799-4a14-b2c8-9de367355d22 |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanols |
| IUPAC Name | 2,5,7-trihydroxy-3-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES (Canonical) | C1=CC(=CC=C1C2C(OC3=CC(=CC(=C3C2=O)O)O)O)O |
| SMILES (Isomeric) | C1=CC(=CC=C1C2C(OC3=CC(=CC(=C3C2=O)O)O)O)O |
| InChI | InChI=1S/C15H12O6/c16-8-3-1-7(2-4-8)12-14(19)13-10(18)5-9(17)6-11(13)21-15(12)20/h1-6,12,15-18,20H |
| InChI Key | UQOJAGBSKPHQOG-UHFFFAOYSA-N |
| Popularity | 12 references in papers |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 107.00 Ų |
| XlogP | 2.00 |
| 2-hydroxyisoflavanone naringenin |
| 2,5,7,4'-tetrahydroxyisoflavanol |
| 2,4',5,7-tetrahydroxyisoflavanone |
| 2,5,7,4'-tetrahydroxyisoflavanone |
| 2,5,7-trihydroxy-3-(4-hydroxyphenyl)chroman-4-one |
| 2,5,7-trihydroxy-3-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| SCHEMBL3445021 |
| CHEBI:31080 |
| UQOJAGBSKPHQOG-UHFFFAOYSA-N |
| 2,5,7-trihydroxy-3-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.04% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.79% | 89.00% |
| CHEMBL3194 | P02766 | Transthyretin | 89.63% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.05% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.82% | 99.15% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.71% | 99.23% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.44% | 91.49% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 85.36% | 96.12% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.28% | 90.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.86% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.39% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.71% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.92% | 98.95% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.56% | 93.40% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.32% | 85.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.94% | 96.09% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 80.51% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Trifolium subterraneum |
| PubChem | 443902 |
| LOTUS | LTS0219862 |
| wikiData | Q27114126 |