2-Hydroxy-1,3-dimethoxy-7H-dibenzo[de,g]quinolin-7-one
| Internal ID | 25240e15-f3c3-4580-8047-2d9399626c4c |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 14,16-dimethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),11,13-heptaene-8,15-dione |
| SMILES (Canonical) | COC1=C2C=CNC3=C2C(=C(C1=O)OC)C4=CC=CC=C4C3=O |
| SMILES (Isomeric) | COC1=C2C=CNC3=C2C(=C(C1=O)OC)C4=CC=CC=C4C3=O |
| InChI | InChI=1S/C18H13NO4/c1-22-17-11-7-8-19-14-12(11)13(18(23-2)16(17)21)9-5-3-4-6-10(9)15(14)20/h3-8,19H,1-2H3 |
| InChI Key | TZZAPJXFLCXBHT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.08445790 g/mol |
| Topological Polar Surface Area (TPSA) | 64.60 Ų |
| XlogP | 1.80 |
| 5574-23-2 |
| DTXSID601207409 |
![2D Structure of 2-Hydroxy-1,3-dimethoxy-7H-dibenzo[de,g]quinolin-7-one](https://plantaedb.com/storage/docs/compounds/2023/11/2-hydroxy-13-dimethoxy-7h-dibenzodegquinolin-7-one.jpg "2D Structure of 2-Hydroxy-1,3-dimethoxy-7H-dibenzo[de,g]quinolin-7-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.47% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.20% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.20% | 93.99% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.30% | 98.95% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 89.66% | 92.67% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.25% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.91% | 94.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.49% | 94.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.46% | 86.33% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.10% | 93.31% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.91% | 99.23% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.54% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pseuduvaria macrophylla |
| PubChem | 71438443 |
| LOTUS | LTS0198431 |
| wikiData | Q105268496 |