2-Hexyl-8-methoxy-1-methylquinolin-4-one
| Internal ID | d222f0ff-efd4-43e8-906b-c3c51324367d |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Hydroquinolones |
| IUPAC Name | 2-hexyl-8-methoxy-1-methylquinolin-4-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H23NO2/c1-4-5-6-7-9-13-12-15(19)14-10-8-11-16(20-3)17(14)18(13)2/h8,10-12H,4-7,9H2,1-3H3 |
| InChI Key | QNZHXLHQSVEFSJ-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.172878976 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.36% | 98.95% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 98.32% | 92.08% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.68% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.54% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.49% | 95.56% |
| CHEMBL240 | Q12809 | HERG | 96.14% | 89.76% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.00% | 93.99% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.93% | 98.75% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 92.77% | 93.31% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.24% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.99% | 96.00% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 89.20% | 89.63% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.79% | 89.62% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 86.16% | 92.38% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.62% | 92.62% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 82.66% | 91.81% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 82.44% | 100.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 82.39% | 90.20% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.05% | 97.25% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.81% | 94.00% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.78% | 96.43% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 80.52% | 96.25% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 80.04% | 87.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Esenbeckia almawillia |
| PubChem | 91664807 |
| LOTUS | LTS0135239 |
| wikiData | Q105224734 |