2-Heptyl-3-hydroxy-4-quinolone
| Internal ID | afc8c644-c3d5-44ab-96d6-4ade100104d5 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Hydroxyquinolones |
| IUPAC Name | 2-heptyl-3-hydroxy-1H-quinolin-4-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H21NO2/c1-2-3-4-5-6-11-14-16(19)15(18)12-9-7-8-10-13(12)17-14/h7-10,19H,2-6,11H2,1H3,(H,17,18) |
| InChI Key | CEIUIHOQDSVZJQ-UHFFFAOYSA-N |
| Popularity | 418 references in papers |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.157228913 g/mol |
| Topological Polar Surface Area (TPSA) | 49.30 Ų |
| XlogP | 4.70 |
| 2-heptyl-3-hydroxy-1H-quinolin-4-one |
| 2-heptyl-3-hydroxy-4(1H)-quinolone |
| 2-Heptyl-3-hydroxy-quinolone |
| Pseudomonas quinolone signal |
| 2-Heptyl-3-hydroxyl-4-quinolone |
| 2-HEPTYLQUINOLINE-3,4-DIOL |
| PQS |
| CHEMBL2426244 |
| CHEBI:29472 |
| 4(1H)-Quinolinone, 2-heptyl-3-hydroxy- |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.08% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.09% | 91.11% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 95.59% | 92.08% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.55% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.04% | 91.49% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.27% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.07% | 96.09% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 90.80% | 85.94% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.33% | 99.23% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 90.06% | 91.71% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 88.36% | 91.81% |
| CHEMBL5979 | P05186 | Alkaline phosphatase, tissue-nonspecific isozyme | 87.45% | 85.40% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 87.44% | 87.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.50% | 94.73% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 84.06% | 98.21% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.61% | 89.00% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 83.53% | 96.37% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.52% | 93.31% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.94% | 99.17% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.83% | 94.75% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 82.16% | 97.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.98% | 94.45% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.75% | 90.08% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.19% | 98.75% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 80.05% | 98.59% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 2763159 |
| LOTUS | LTS0221696 |
| wikiData | Q27110090 |