2-Hepten-4-one, 6-(2-hydroxy-4-methylphenyl)-2-methyl-
Internal ID | 1b90ed57-8f98-43df-8338-8d7293adf220 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | 6-(2-hydroxy-4-methylphenyl)-2-methylhept-2-en-4-one |
SMILES (Canonical) | CC1=CC(=C(C=C1)C(C)CC(=O)C=C(C)C)O |
SMILES (Isomeric) | CC1=CC(=C(C=C1)C(C)CC(=O)C=C(C)C)O |
InChI | InChI=1S/C15H20O2/c1-10(2)7-13(16)9-12(4)14-6-5-11(3)8-15(14)17/h5-8,12,17H,9H2,1-4H3 |
InChI Key | WYIJOOQDLOBLCP-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C15H20O2 |
Molecular Weight | 232.32 g/mol |
Exact Mass | 232.146329876 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 3.90 |
2-Hepten-4-one, 6-(2-hydroxy-4-methylphenyl)-2-methyl- |
6-(2-Hydroxy-4-methylphenyl)-2-methylhept-2-en-4-one |
(+)-Turmeronol B |
139085-15-7 |
SCHEMBL6422167 |
DTXSID20449715 |
WYIJOOQDLOBLCP-UHFFFAOYSA-N |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.26% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.08% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.06% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.16% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.24% | 96.09% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.27% | 97.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.83% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.38% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.18% | 89.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.55% | 96.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.11% | 96.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.64% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.92% | 99.17% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.69% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Curcuma longa |
PubChem | 10955433 |
LOTUS | LTS0083415 |
wikiData | Q82269232 |