2-Heptadeca-9,11-dienyl-6-hydroxybenzoic acid
| Internal ID | 17c719a5-31b4-4302-9747-23184d6a910d |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Salicylic acid and derivatives > Salicylic acids |
| IUPAC Name | 2-heptadeca-9,11-dienyl-6-hydroxybenzoic acid |
| SMILES (Canonical) | CCCCCC=CC=CCCCCCCCCC1=C(C(=CC=C1)O)C(=O)O |
| SMILES (Isomeric) | CCCCCC=CC=CCCCCCCCCC1=C(C(=CC=C1)O)C(=O)O |
| InChI | InChI=1S/C24H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-21-19-17-20-22(25)23(21)24(26)27/h6-9,17,19-20,25H,2-5,10-16,18H2,1H3,(H,26,27) |
| InChI Key | YEMBMEOYBBHCGI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.26644501 g/mol |
| Topological Polar Surface Area (TPSA) | 57.50 Ų |
| XlogP | 9.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.81% | 98.95% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 96.12% | 89.63% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 95.94% | 92.08% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.51% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.86% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.00% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.97% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.83% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.73% | 86.33% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.88% | 93.56% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 85.50% | 96.25% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.17% | 96.95% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.40% | 96.00% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 83.83% | 97.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.48% | 93.31% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.23% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ginkgo biloba |
| PubChem | 163031728 |
| LOTUS | LTS0158151 |
| wikiData | Q105347302 |