2-Ethoxy-4,5-dihydroxybenzoic acid
| Internal ID | c81b253b-9a41-410c-a5ea-bc17c920fe77 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Hydroxybenzoic acid derivatives |
| IUPAC Name | 2-ethoxy-4,5-dihydroxybenzoic acid |
| SMILES (Canonical) | CCOC1=CC(=C(C=C1C(=O)O)O)O |
| SMILES (Isomeric) | CCOC1=CC(=C(C=C1C(=O)O)O)O |
| InChI | InChI=1S/C9H10O5/c1-2-14-8-4-7(11)6(10)3-5(8)9(12)13/h3-4,10-11H,2H2,1H3,(H,12,13) |
| InChI Key | YPZCRKPXYSWLJF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05282342 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.27% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.82% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.42% | 91.11% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 87.75% | 95.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.70% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.50% | 95.56% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.27% | 97.21% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.92% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.24% | 90.00% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 83.98% | 82.50% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.19% | 96.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.09% | 98.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.78% | 94.73% |
| CHEMBL3194 | P02766 | Transthyretin | 80.38% | 90.71% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.23% | 94.42% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.19% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aralia armata |
| Gonzalezia decurrens |
| Heliotropium sarmentosum |
| Panax japonicus |
| PubChem | 10821779 |
| LOTUS | LTS0197192 |
| wikiData | Q105210888 |