(2-Ethenyl-2,4b,8,8-tetramethyl-10-oxo-1,3,4,5,6,7,8a,9-octahydrophenanthren-3-yl) acetate
| Internal ID | cb16985e-cfad-4ab5-88b1-083a9b69ee6b |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | (2-ethenyl-2,4b,8,8-tetramethyl-10-oxo-1,3,4,5,6,7,8a,9-octahydrophenanthren-3-yl) acetate |
| SMILES (Canonical) | CC(=O)OC1CC2=C(CC1(C)C=C)C(=O)CC3C2(CCCC3(C)C)C |
| SMILES (Isomeric) | CC(=O)OC1CC2=C(CC1(C)C=C)C(=O)CC3C2(CCCC3(C)C)C |
| InChI | InChI=1S/C22H32O3/c1-7-21(5)13-15-16(11-19(21)25-14(2)23)22(6)10-8-9-20(3,4)18(22)12-17(15)24/h7,18-19H,1,8-13H2,2-6H3 |
| InChI Key | QSGPAMWFRMOPST-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23514488 g/mol |
| Topological Polar Surface Area (TPSA) | 43.40 Ų |
| XlogP | 5.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.18% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.53% | 94.45% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 91.45% | 97.05% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.81% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.85% | 85.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.97% | 91.19% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.98% | 98.95% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.69% | 93.04% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.26% | 97.25% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.99% | 82.69% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.84% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.51% | 95.56% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.14% | 91.07% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.21% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.92% | 93.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.71% | 89.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.58% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vellozia compacta |
| PubChem | 14287362 |
| LOTUS | LTS0100789 |
| wikiData | Q104196149 |