CID 10420568
| Internal ID | cfe0a129-f2ec-4c32-891a-0cd965c37d37 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Quinone and hydroquinone lipids > Prenylated hydroquinones |
| IUPAC Name | 2-[(E)-3-methoxy-3-methylbut-1-enyl]benzene-1,4-diol |
| SMILES (Canonical) | CC(C)(C=CC1=C(C=CC(=C1)O)O)OC |
| SMILES (Isomeric) | CC(C)(/C=C/C1=C(C=CC(=C1)O)O)OC |
| InChI | InChI=1S/C12H16O3/c1-12(2,15-3)7-6-9-8-10(13)4-5-11(9)14/h4-8,13-14H,1-3H3/b7-6+ |
| InChI Key | IMZFUPJSYGVBOH-VOTSOKGWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.109944368 g/mol |
| Topological Polar Surface Area (TPSA) | 49.70 Ų |
| XlogP | 2.10 |
| F-11334-B2 |
| CHEBI:203229 |
| BDBM50407370 |
| 2-[(E)-3-methoxy-3-methylbut-1-enyl]benzene-1,4-diol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.04% | 91.11% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 91.61% | 98.35% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.14% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.93% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.15% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.02% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.57% | 94.73% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 85.37% | 91.49% |
| CHEMBL3194 | P02766 | Transthyretin | 85.27% | 90.71% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 84.00% | 98.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.56% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.54% | 99.15% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 80.08% | 90.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10420568 |
| LOTUS | LTS0188783 |
| wikiData | Q77376267 |