2-[(E)-3-(4-hydroxy-3-methoxyphenoxy)prop-2-enyl]-6-methoxy-4-prop-2-enylphenol
Internal ID | d763ac6d-f959-438e-a7d1-84c8b2cde9e2 |
Taxonomy | Benzenoids > Phenols > Methoxyphenols |
IUPAC Name | 2-[(E)-3-(4-hydroxy-3-methoxyphenoxy)prop-2-enyl]-6-methoxy-4-prop-2-enylphenol |
SMILES (Canonical) | COC1=CC(=CC(=C1O)CC=COC2=CC(=C(C=C2)O)OC)CC=C |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)C/C=C/OC2=CC(=C(C=C2)O)OC)CC=C |
InChI | InChI=1S/C20H22O5/c1-4-6-14-11-15(20(22)19(12-14)24-3)7-5-10-25-16-8-9-17(21)18(13-16)23-2/h4-5,8-13,21-22H,1,6-7H2,2-3H3/b10-5+ |
InChI Key | VRELCUVYUBGICK-BJMVGYQFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H22O5 |
Molecular Weight | 342.40 g/mol |
Exact Mass | 342.14672380 g/mol |
Topological Polar Surface Area (TPSA) | 68.20 Ų |
XlogP | 4.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.47% | 91.11% |
CHEMBL240 | Q12809 | HERG | 96.87% | 89.76% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.14% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.68% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.71% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.60% | 90.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.94% | 91.49% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.98% | 89.62% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.55% | 99.15% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 88.84% | 95.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.58% | 92.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.84% | 95.56% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 86.81% | 90.20% |
CHEMBL2581 | P07339 | Cathepsin D | 85.02% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.89% | 95.89% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.60% | 90.24% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.58% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.02% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ocimum tenuiflorum |
PubChem | 25231264 |
LOTUS | LTS0269002 |
wikiData | Q105291710 |