cis-2-Hydroxy 4-methoxycinnamic acid 2-glucoside
Internal ID | 763638f2-0b92-4839-b6cc-621a91bc7914 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | (Z)-3-[4-methoxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoic acid |
SMILES (Canonical) | COC1=CC(=C(C=C1)C=CC(=O)O)OC2C(C(C(C(O2)CO)O)O)O |
SMILES (Isomeric) | COC1=CC(=C(C=C1)/C=C\C(=O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
InChI | InChI=1S/C16H20O9/c1-23-9-4-2-8(3-5-12(18)19)10(6-9)24-16-15(22)14(21)13(20)11(7-17)25-16/h2-6,11,13-17,20-22H,7H2,1H3,(H,18,19)/b5-3-/t11-,13-,14+,15-,16-/m1/s1 |
InChI Key | FQWZGEBZILOCET-QEQKPWIDSA-N |
Popularity | 5 references in papers |
Molecular Formula | C16H20O9 |
Molecular Weight | 356.32 g/mol |
Exact Mass | 356.11073221 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | -0.60 |
MEGxp0_001980 |
2-beta-D-Glucopyranosyloxy-4-methoxy-cis-cinnamic acid |
CHEBI:181633 |
AKOS040739179 |
NCGC00384792-01 |
cis-2-beta-d-glucopyranosyloxy-4-methoxy-cinnamic acid |
(Z)-3-[4-methoxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoic acid |
NCGC00384792-01_C16H20O9_2-Propenoic acid, 3-[2-(beta-D-glucopyranosyloxy)-4-methoxyphenyl]-, (2Z)- |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.52% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 97.08% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.05% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.14% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.45% | 99.17% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.41% | 97.36% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.69% | 95.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.87% | 86.92% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.66% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.45% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.83% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.38% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 83.46% | 98.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.68% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chrysanthemum indicum |
PubChem | 24094157 |
LOTUS | LTS0087087 |
wikiData | Q104999970 |