2'-(beta-D-Glucopyranosyloxy)-3,5,6',7-tetrahydroxyflavone
Internal ID | ee4ac11b-6ecd-43e1-84a1-41c262f73b50 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > Flavonols |
IUPAC Name | 3,5,7-trihydroxy-2-[2-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
SMILES (Canonical) | C1=CC(=C(C(=C1)OC2C(C(C(C(O2)CO)O)O)O)C3=C(C(=O)C4=C(C=C(C=C4O3)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C(=C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)C3=C(C(=O)C4=C(C=C(C=C4O3)O)O)O)O |
InChI | InChI=1S/C21H20O12/c22-6-12-15(26)17(28)19(30)21(33-12)32-10-3-1-2-8(24)14(10)20-18(29)16(27)13-9(25)4-7(23)5-11(13)31-20/h1-5,12,15,17,19,21-26,28-30H,6H2/t12-,15-,17+,19-,21-/m1/s1 |
InChI Key | WLCYEFFWFTVKQR-GFOOFYSOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H20O12 |
Molecular Weight | 464.40 g/mol |
Exact Mass | 464.09547607 g/mol |
Topological Polar Surface Area (TPSA) | 207.00 Ų |
XlogP | 0.40 |
Compound NP-017380 |
2'-(beta-D-Glucopyranosyloxy)-3,5,6',7-tetrahydroxyflavone |
AKOS040735571 |
3,5,7-trihydroxy-2-[2-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.40% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.40% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.52% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 94.98% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.55% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.49% | 95.56% |
CHEMBL220 | P22303 | Acetylcholinesterase | 92.62% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.32% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 90.60% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.99% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.47% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.22% | 94.45% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.57% | 96.21% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.25% | 95.89% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 84.21% | 96.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.14% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.11% | 99.23% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.84% | 86.92% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.81% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.36% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Scutellaria amoena |
PubChem | 51136588 |
LOTUS | LTS0159609 |
wikiData | Q105307881 |