2-Benzylideneoctanal
Internal ID | b6f606c9-0757-4b59-a7af-e8efaa601727 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamaldehydes |
IUPAC Name | (2Z)-2-benzylideneoctanal |
SMILES (Canonical) | CCCCCCC(=CC1=CC=CC=C1)C=O |
SMILES (Isomeric) | CCCCCC/C(=C/C1=CC=CC=C1)/C=O |
InChI | InChI=1S/C15H20O/c1-2-3-4-6-11-15(13-16)12-14-9-7-5-8-10-14/h5,7-10,12-13H,2-4,6,11H2,1H3/b15-12- |
InChI Key | GUUHFMWKWLOQMM-QINSGFPZSA-N |
Popularity | 22 references in papers |
Molecular Formula | C15H20O |
Molecular Weight | 216.32 g/mol |
Exact Mass | 216.151415257 g/mol |
Topological Polar Surface Area (TPSA) | 17.10 Ų |
XlogP | 4.80 |
alpha-Hexylcinnamaldehyde |
101-86-0 |
Hexyl cinnamic aldehyde |
UNII-H2WS93I0OP |
(2Z)-2-benzylideneoctanal |
Octanal, 2-(phenylmethylene)- |
H2WS93I0OP |
2-Hexylcinnamaldehyde |
NSC 406799 |
FEMA No. 2569 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.96% | 98.95% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 94.96% | 92.08% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.61% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.80% | 99.17% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 92.49% | 85.94% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.73% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.21% | 94.73% |
CHEMBL240 | Q12809 | HERG | 91.01% | 89.76% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.56% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.11% | 86.33% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 89.69% | 89.63% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.96% | 90.17% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.86% | 94.62% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.39% | 94.08% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.56% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bupleurum chinense |
Bupleurum falcatum |
Bupleurum scorzonerifolium |