2-Anthracenecarboxylicacid, 3-ethyl-9,10-dihydro-1-hydroxy-6,8-dimethoxy-9,10-dioxo-
| Internal ID | a34d80ca-c0a1-4286-a48e-f7acc1ec13b2 |
| Taxonomy | Benzenoids > Anthracenes > Anthracenecarboxylic acids and derivatives > Anthracenecarboxylic acids |
| IUPAC Name | 3-ethyl-1-hydroxy-6,8-dimethoxy-9,10-dioxoanthracene-2-carboxylic acid |
| SMILES (Canonical) | CCC1=CC2=C(C(=C1C(=O)O)O)C(=O)C3=C(C2=O)C=C(C=C3OC)OC |
| SMILES (Isomeric) | CCC1=CC2=C(C(=C1C(=O)O)O)C(=O)C3=C(C2=O)C=C(C=C3OC)OC |
| InChI | InChI=1S/C19H16O7/c1-4-8-5-10-15(17(21)13(8)19(23)24)18(22)14-11(16(10)20)6-9(25-2)7-12(14)26-3/h5-7,21H,4H2,1-3H3,(H,23,24) |
| InChI Key | ONXOCWXYHAUVJJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H16O7 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.08960285 g/mol |
| Topological Polar Surface Area (TPSA) | 110.00 Ų |
| XlogP | 3.30 |
| 2-Anthracenecarboxylicacid, 3-ethyl-9,10-dihydro-1-hydroxy-6,8-dimethoxy-9,10-dioxo- |
| DTXSID20473898 |
| RefChem:256112 |
| DTXCID50424712 |
| SCHEMBL16226879 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.88% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.69% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.98% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.61% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.52% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.64% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.07% | 96.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 89.06% | 94.42% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.13% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.23% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.64% | 89.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.17% | 90.20% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.16% | 94.00% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 82.88% | 96.09% |
| CHEMBL3194 | P02766 | Transthyretin | 82.70% | 90.71% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.06% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11824434 |
| LOTUS | LTS0069210 |
| wikiData | Q82303574 |