2-Aminopyrimidine-4-carboxylic acid
| Internal ID | bd21354f-4236-4fac-8ba0-d104e6032195 |
| Taxonomy | Organoheterocyclic compounds > Diazines > Pyrimidines and pyrimidine derivatives > Pyrimidinecarboxylic acids and derivatives > Pyrimidinecarboxylic acids |
| IUPAC Name | 2-aminopyrimidine-4-carboxylic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C5H5N3O2/c6-5-7-2-1-3(8-5)4(9)10/h1-2H,(H,9,10)(H2,6,7,8) |
| InChI Key | GKFPFLBDQJVJIH-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C5H5N3O2 |
| Molecular Weight | 139.11 g/mol |
| Exact Mass | 139.038176411 g/mol |
| Topological Polar Surface Area (TPSA) | 89.10 Ų |
| XlogP | -0.30 |
| 2164-65-0 |
| 2-Amino-pyrimidine-4-carboxylic acid |
| 2-amino-4-pyrimidinecarboxylic acid |
| MFCD07783936 |
| 4-PYRIMIDINECARBOXYLIC ACID, 2-AMINO- |
| NSC61555 |
| 2-Amino-pyrimidine-4-carboxylicacid |
| 2-Amino-4-carboxypyrimidin |
| SCHEMBL1457909 |
| DTXSID10289480 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.24% | 96.09% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 90.43% | 95.71% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 85.89% | 94.42% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 84.52% | 81.11% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 81.55% | 95.48% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.45% | 86.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.91% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lathyrus tingitanus |
| PubChem | 247194 |
| LOTUS | LTS0223674 |
| wikiData | Q72441798 |