2-aminobenzoylacetyl-CoA
| Internal ID | c9e6c15f-03ca-490e-9a92-83911855612c |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl thioesters > Acyl CoAs > 3-oxo-acyl CoAs |
| IUPAC Name | S-[2-[3-[[(2R)-4-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] 3-(2-aminophenyl)-3-oxopropanethioate |
| SMILES (Canonical) | CC(C)(COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)C(C(=O)NCCC(=O)NCCSC(=O)CC(=O)C4=CC=CC=C4N)O |
| SMILES (Isomeric) | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)[C@H](C(=O)NCCC(=O)NCCSC(=O)CC(=O)C4=CC=CC=C4N)O |
| InChI | InChI=1S/C30H43N8O18P3S/c1-30(2,25(43)28(44)34-8-7-20(40)33-9-10-60-21(41)11-18(39)16-5-3-4-6-17(16)31)13-53-59(50,51)56-58(48,49)52-12-19-24(55-57(45,46)47)23(42)29(54-19)38-15-37-22-26(32)35-14-36-27(22)38/h3-6,14-15,19,23-25,29,42-43H,7-13,31H2,1-2H3,(H,33,40)(H,34,44)(H,48,49)(H,50,51)(H2,32,35,36)(H2,45,46,47)/t19-,23-,24-,25+,29-/m1/s1 |
| InChI Key | OLOTULRNHWZRKJ-FUEUKBNZSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C30H43N8O18P3S |
| Molecular Weight | 928.70 g/mol |
| Exact Mass | 928.16288872 g/mol |
| Topological Polar Surface Area (TPSA) | 432.00 Ų |
| XlogP | -4.30 |
| 2-aminobenzoylacetyl-coenzyme A |
| CHEBI:131952 |
| 3'-phosphoadenosine 5'-{3-[(3R)-4-({3-[(2-{[3-(2-aminophenyl)-3-oxopropanoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| 3'-phosphoadenosine 5'-(3-((3R)-4-((3-((2-((3-(2-aminophenyl)-3-oxopropanoyl)sulfanyl)ethyl)amino)-3-oxopropyl)amino)-3-hydroxy-2,2-dimethyl-4-oxobutyl) dihydrogen diphosphate) |
| S-(2-(3-(((2R)-4-((((2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl)methoxy-hydroxyphosphoryl)oxy-hydroxyphosphoryl)oxy-2-hydroxy-3,3-dimethylbutanoyl)amino)propanoylamino)ethyl) 3-(2-aminophenyl)-3-oxopropanethioate |
| S-[2-[3-[[(2R)-4-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] 3-(2-aminophenyl)-3-oxopropanethioate |
| RefChem:85367 |
| 1812866-39-9 |
| orb3022237 |
| TXB-00708 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.47% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.81% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 96.75% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 96.54% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.81% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.67% | 99.17% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 93.32% | 95.00% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 93.28% | 80.33% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 90.28% | 89.34% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.68% | 98.75% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.48% | 90.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.20% | 96.00% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 86.82% | 93.81% |
| CHEMBL3891 | P07384 | Calpain 1 | 85.48% | 93.04% |
| CHEMBL5028 | O14672 | ADAM10 | 85.32% | 97.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.82% | 89.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 83.66% | 95.93% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 83.62% | 82.86% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.80% | 95.56% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.42% | 97.29% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.28% | 98.33% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.15% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 118797972 |
| LOTUS | LTS0076420 |
| wikiData | Q27225319 |