2-Aminobenzimidazole
| Internal ID | f015e77a-9068-46d0-b8ef-825a578695e9 |
| Taxonomy | Organoheterocyclic compounds > Benzimidazoles |
| IUPAC Name | 1H-benzimidazol-2-amine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C7H7N3/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H3,8,9,10) |
| InChI Key | JWYUFVNJZUSCSM-UHFFFAOYSA-N |
| Popularity | 912 references in papers |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.063997236 g/mol |
| Topological Polar Surface Area (TPSA) | 54.70 Ų |
| XlogP | 0.90 |
| 934-32-7 |
| 1H-Benzimidazol-2-amine |
| 2-Iminobenzimidazoline |
| USAF EK-4037 |
| DTXSID1024465 |
| CHEBI:27822 |
| E65DE7521V |
| NSC-7628 |
| NSC-27793 |
| DTXCID004465 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
19952.6 nM |
Potency |
via CMAUP
|
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing |
4100 nM |
IC50 |
PMID: 23664164
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 93.08% | 94.62% |
| CHEMBL1952 | P04818 | Thymidylate synthase | 92.37% | 93.53% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.22% | 91.11% |
| CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 84.92% | 91.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.65% | 95.56% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 82.80% | 97.00% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 82.35% | 93.81% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 81.98% | 95.48% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 81.37% | 85.30% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.16% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Oreocome striata |
| PubChem | 13624 |
| NPASS | NPC317642 |
| ChEMBL | CHEMBL305513 |