2-amino-7-methyl-1,5-dihydropteridine-4,6-dione
| Internal ID | 32425359-bc83-4d3f-b38c-95faff534f68 |
| Taxonomy | Organoheterocyclic compounds > Pteridines and derivatives > Pterins and derivatives |
| IUPAC Name | 2-amino-7-methyl-1,5-dihydropteridine-4,6-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C7H7N5O2/c1-2-5(13)10-3-4(9-2)11-7(8)12-6(3)14/h1H3,(H,10,13)(H3,8,9,11,12,14) |
| InChI Key | QHJGJOBIIBEJNN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C7H7N5O2 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.05997448 g/mol |
| Topological Polar Surface Area (TPSA) | 109.00 Ų |
| XlogP | -2.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.51% | 83.82% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 89.76% | 85.30% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.01% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.93% | 99.23% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.03% | 85.14% |
| CHEMBL4072 | P07858 | Cathepsin B | 86.81% | 93.67% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.81% | 94.73% |
| CHEMBL262 | P49841 | Glycogen synthase kinase-3 beta | 83.67% | 95.72% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 83.63% | 98.59% |
| CHEMBL1952 | P04818 | Thymidylate synthase | 83.59% | 93.53% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.85% | 94.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.77% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 96726 |
| LOTUS | LTS0209357 |
| wikiData | Q83070492 |