2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-3-methyl-4a,8a-dihydropteridin-4-one
| Internal ID | 3866daec-6e44-40cc-b9fc-a08ed899d8c5 |
| Taxonomy | Organoheterocyclic compounds > Pteridines and derivatives > Pterins and derivatives > Biopterins and derivatives |
| IUPAC Name | 2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-3-methyl-4a,8a-dihydropteridin-4-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H15N5O3/c1-4(16)7(17)5-3-12-8-6(13-5)9(18)15(2)10(11)14-8/h3-4,6-8,16-17H,1-2H3,(H2,11,14)/t4-,6?,7-,8?/m0/s1 |
| InChI Key | UMUUWVPUJRLIRT-OUDCPYHZSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C10H15N5O3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11748936 g/mol |
| Topological Polar Surface Area (TPSA) | 124.00 Ų |
| XlogP | -2.70 |
| There are no found synonyms. |
![2D Structure of 2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-3-methyl-4a,8a-dihydropteridin-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/2-amino-6-1r2s-12-dihydroxypropyl-3-methyl-4a8a-dihydropteridin-4-one.jpg "2D Structure of 2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-3-methyl-4a,8a-dihydropteridin-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.23% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.48% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.36% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.58% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.39% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.10% | 97.25% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.30% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.67% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.17% | 95.89% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 80.36% | 98.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162817304 |
| LOTUS | LTS0135921 |
| wikiData | Q105275756 |