2-Amino-5-[2-(2-hydroxyphenyl)hydrazinyl]-5-oxopentanoic acid
| Internal ID | 7e5ca5e2-bb1e-40ba-b89e-998093860251 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Glutamine and derivatives |
| IUPAC Name | 2-amino-5-[2-(2-hydroxyphenyl)hydrazinyl]-5-oxopentanoic acid |
| SMILES (Canonical) | C1=CC=C(C(=C1)NNC(=O)CCC(C(=O)O)N)O |
| SMILES (Isomeric) | C1=CC=C(C(=C1)NNC(=O)CCC(C(=O)O)N)O |
| InChI | InChI=1S/C11H15N3O4/c12-7(11(17)18)5-6-10(16)14-13-8-3-1-2-4-9(8)15/h1-4,7,13,15H,5-6,12H2,(H,14,16)(H,17,18) |
| InChI Key | CRSVHQICRXRCEP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10625597 g/mol |
| Topological Polar Surface Area (TPSA) | 125.00 Ų |
| XlogP | -1.70 |
| There are no found synonyms. |
![2D Structure of 2-Amino-5-[2-(2-hydroxyphenyl)hydrazinyl]-5-oxopentanoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/2-amino-5-2-2-hydroxyphenylhydrazinyl-5-oxopentanoic-acid.jpg "2D Structure of 2-Amino-5-[2-(2-hydroxyphenyl)hydrazinyl]-5-oxopentanoic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.00% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.42% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.60% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.73% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.41% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.63% | 96.09% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.28% | 94.62% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 88.12% | 94.08% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.81% | 99.15% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.41% | 90.20% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.71% | 99.23% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.32% | 95.50% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.90% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.87% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 46212659 |
| LOTUS | LTS0096016 |
| wikiData | Q103817981 |