2-Acetyl-5-hydroxy-11-methyl-1,2-dihydrofuro[2,3-c]acridin-6-one
| Internal ID | d53853e3-b8fc-4857-8362-a111e869359c |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | 2-acetyl-5-hydroxy-11-methyl-1,2-dihydrofuro[2,3-c]acridin-6-one |
| SMILES (Canonical) | CC(=O)C1CC2=C(O1)C=C(C3=C2N(C4=CC=CC=C4C3=O)C)O |
| SMILES (Isomeric) | CC(=O)C1CC2=C(O1)C=C(C3=C2N(C4=CC=CC=C4C3=O)C)O |
| InChI | InChI=1S/C18H15NO4/c1-9(20)14-7-11-15(23-14)8-13(21)16-17(11)19(2)12-6-4-3-5-10(12)18(16)22/h3-6,8,14,21H,7H2,1-2H3 |
| InChI Key | VZPCHUBLCFMBQM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.10010796 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 3.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.08% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.92% | 89.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.87% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.46% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.11% | 85.14% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.18% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.96% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.24% | 99.23% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.05% | 93.40% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 90.42% | 93.65% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 89.73% | 100.00% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 88.45% | 95.62% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.00% | 91.49% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.43% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.88% | 86.33% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 84.64% | 80.71% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.52% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Thamnosma montana |
| PubChem | 11034226 |
| LOTUS | LTS0129333 |
| wikiData | Q105299907 |