2-Acetyl-5-acetylbenzofuran
Internal ID | 3d08c604-7fe2-4776-8efb-ba824217a9b5 |
Taxonomy | Organoheterocyclic compounds > Benzofurans |
IUPAC Name | 1-(2-acetyl-1-benzofuran-5-yl)ethanone |
SMILES (Canonical) | CC(=O)C1=CC2=C(C=C1)OC(=C2)C(=O)C |
SMILES (Isomeric) | CC(=O)C1=CC2=C(C=C1)OC(=C2)C(=O)C |
InChI | InChI=1S/C12H10O3/c1-7(13)9-3-4-11-10(5-9)6-12(15-11)8(2)14/h3-6H,1-2H3 |
InChI Key | QKNUQRIOFNUYQG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C12H10O3 |
Molecular Weight | 202.21 g/mol |
Exact Mass | 202.062994177 g/mol |
Topological Polar Surface Area (TPSA) | 47.30 Ų |
XlogP | 2.00 |
NSC247532 |
Benzofuran,5-diacetyl- |
2-Acetyl-5-acetylbenzofuran |
SCHEMBL15623111 |
DTXSID60311927 |
NSC-247532 |
Ethanone,1'-(2,5-benzofurandiyl)bis- |
1,1'-(1-Benzofuran-2,5-diyl)di(ethan-1-one) |
![2D Structure of 2-Acetyl-5-acetylbenzofuran 2D Structure of 2-Acetyl-5-acetylbenzofuran](https://plantaedb.com/storage/docs/compounds/2023/11/2-acetyl-5-acetylbenzofuran.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2039 | P27338 | Monoamine oxidase B | 93.00% | 92.51% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.88% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.67% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.12% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.79% | 90.00% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.68% | 93.65% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 83.19% | 87.67% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.10% | 96.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.85% | 94.00% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 82.31% | 81.11% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.08% | 94.42% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.99% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ophryosporus charua |
PubChem | 317197 |
LOTUS | LTS0104455 |
wikiData | Q82062133 |