2-(7-Hydroxy-2,2-dimethyl-3,4-dihydrochromen-5-yl)-7-(2-methylbut-3-en-2-yl)-1-benzofuran-4,6-diol
| Internal ID | 0339b1e6-e271-4307-8d31-996167b94660 |
| Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
| IUPAC Name | 2-(7-hydroxy-2,2-dimethyl-3,4-dihydrochromen-5-yl)-7-(2-methylbut-3-en-2-yl)-1-benzofuran-4,6-diol |
| SMILES (Canonical) | CC1(CCC2=C(C=C(C=C2O1)O)C3=CC4=C(O3)C(=C(C=C4O)O)C(C)(C)C=C)C |
| SMILES (Isomeric) | CC1(CCC2=C(C=C(C=C2O1)O)C3=CC4=C(O3)C(=C(C=C4O)O)C(C)(C)C=C)C |
| InChI | InChI=1S/C24H26O5/c1-6-23(2,3)21-18(27)12-17(26)16-11-19(28-22(16)21)15-9-13(25)10-20-14(15)7-8-24(4,5)29-20/h6,9-12,25-27H,1,7-8H2,2-5H3 |
| InChI Key | KONDXJGLYNZBFK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17802393 g/mol |
| Topological Polar Surface Area (TPSA) | 83.10 Ų |
| XlogP | 5.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.17% | 91.11% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 97.52% | 98.35% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.40% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.46% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.64% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.16% | 89.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.52% | 93.40% |
| CHEMBL233 | P35372 | Mu opioid receptor | 86.28% | 97.93% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.71% | 86.33% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 85.54% | 90.93% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.16% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.76% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.21% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artocarpus petelotii |
| PubChem | 102074559 |
| LOTUS | LTS0185935 |
| wikiData | Q105143890 |