2-[6-Hydroxy-3,4-bis(4-hydroxy-3-methoxyphenyl)hexoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
| Internal ID | f4251fe5-a294-407b-b774-ffc496972472 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes > Stilbene glycosides |
| IUPAC Name | 2-[6-hydroxy-3,4-bis(4-hydroxy-3-methoxyphenyl)hexoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES (Canonical) | COC1=C(C=CC(=C1)C(CCO)C(CCOC2C(C(C(C(O2)CO)O)O)O)C3=CC(=C(C=C3)O)OC)O |
| SMILES (Isomeric) | COC1=C(C=CC(=C1)C(CCO)C(CCOC2C(C(C(C(O2)CO)O)O)O)C3=CC(=C(C=C3)O)OC)O |
| InChI | InChI=1S/C26H36O11/c1-34-20-11-14(3-5-18(20)29)16(7-9-27)17(15-4-6-19(30)21(12-15)35-2)8-10-36-26-25(33)24(32)23(31)22(13-28)37-26/h3-6,11-12,16-17,22-33H,7-10,13H2,1-2H3 |
| InChI Key | BFTMSSAJWZRYLC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H36O11 |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.22576196 g/mol |
| Topological Polar Surface Area (TPSA) | 179.00 Ų |
| XlogP | 0.70 |
| There are no found synonyms. |
![2D Structure of 2-[6-Hydroxy-3,4-bis(4-hydroxy-3-methoxyphenyl)hexoxy]-6-(hydroxymethyl)oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/2-6-hydroxy-34-bis4-hydroxy-3-methoxyphenylhexoxy-6-hydroxymethyloxane-345-triol.jpg "2D Structure of 2-[6-Hydroxy-3,4-bis(4-hydroxy-3-methoxyphenyl)hexoxy]-6-(hydroxymethyl)oxane-3,4,5-triol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.18% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.99% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.11% | 99.17% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 92.23% | 89.62% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.74% | 96.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.73% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.71% | 94.45% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.45% | 99.15% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.61% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.69% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.38% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.72% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.92% | 95.89% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.33% | 92.94% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.40% | 92.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.07% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pinus massoniana |
| PubChem | 162846534 |
| LOTUS | LTS0197970 |
| wikiData | Q104934857 |