2-(5-Methoxy-1-methyl-11-methylidene-4-oxatricyclo[5.3.1.02,6]undecan-8-yl)propan-2-ol
| Internal ID | f8999f0f-cbe4-449b-bb59-a1a31cfaffbb |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 2-(5-methoxy-1-methyl-11-methylidene-4-oxatricyclo[5.3.1.02,6]undecan-8-yl)propan-2-ol |
| SMILES (Canonical) | CC12CCC(C(C1=C)C3C2COC3OC)C(C)(C)O |
| SMILES (Isomeric) | CC12CCC(C(C1=C)C3C2COC3OC)C(C)(C)O |
| InChI | InChI=1S/C16H26O3/c1-9-12-10(15(2,3)17)6-7-16(9,4)11-8-19-14(18-5)13(11)12/h10-14,17H,1,6-8H2,2-5H3 |
| InChI Key | QNDSAVLUJWRTMD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.18819469 g/mol |
| Topological Polar Surface Area (TPSA) | 38.70 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
![2D Structure of 2-(5-Methoxy-1-methyl-11-methylidene-4-oxatricyclo[5.3.1.02,6]undecan-8-yl)propan-2-ol](https://plantaedb.com/storage/docs/compounds/2023/11/2-5-methoxy-1-methyl-11-methylidene-4-oxatricyclo531026undecan-8-ylpropan-2-ol.jpg "2D Structure of 2-(5-Methoxy-1-methyl-11-methylidene-4-oxatricyclo[5.3.1.02,6]undecan-8-yl)propan-2-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.63% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.51% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.77% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.46% | 83.82% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.44% | 92.94% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.45% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.38% | 95.89% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.56% | 97.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.30% | 100.00% |
| CHEMBL1871 | P10275 | Androgen Receptor | 83.16% | 96.43% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.11% | 92.62% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.59% | 94.00% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.10% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73837220 |
| LOTUS | LTS0122058 |
| wikiData | Q104195988 |