2-(5-hydroxy-4-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-1-yl)benzene-1,4-diol
| Internal ID | c5082d41-a849-4934-869f-b867cc34d21c |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Phenylpyridines |
| IUPAC Name | 2-(5-hydroxy-4-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-1-yl)benzene-1,4-diol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H15NO3/c1-8-7-16-15(10-3-5-13(19)14(8)10)11-6-9(17)2-4-12(11)18/h2,4,6-7,13,17-19H,3,5H2,1H3 |
| InChI Key | YQOMGYYSWFJSPK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.10519334 g/mol |
| Topological Polar Surface Area (TPSA) | 73.60 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
![2D Structure of 2-(5-hydroxy-4-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-1-yl)benzene-1,4-diol](https://plantaedb.com/storage/docs/compounds/2023/11/2-5-hydroxy-4-methyl-67-dihydro-5h-cyclopentacpyridin-1-ylbenzene-14-diol.jpg "2D Structure of 2-(5-hydroxy-4-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-1-yl)benzene-1,4-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.94% | 91.49% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 96.92% | 91.79% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 94.60% | 95.70% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.04% | 99.15% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.81% | 91.11% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 88.21% | 96.09% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.90% | 89.62% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.72% | 93.40% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.65% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.62% | 89.00% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 86.67% | 97.53% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.58% | 96.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.54% | 90.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.91% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.79% | 86.33% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 85.64% | 93.10% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.28% | 98.95% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.90% | 95.89% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.62% | 92.94% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.48% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.64% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.37% | 99.17% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.04% | 95.78% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.46% | 93.65% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.65% | 95.56% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 81.24% | 85.49% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.78% | 97.09% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 80.22% | 91.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163064656 |
| LOTUS | LTS0134532 |
| wikiData | Q104201981 |