2-(5-Amino-1-methyl-4,7-dioxoindol-3-yl)-1,3-thiazole-4-carboxamide
| Internal ID | b0d29b11-af15-4001-a310-f2cfc07dcddd |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives |
| IUPAC Name | 2-(5-amino-1-methyl-4,7-dioxoindol-3-yl)-1,3-thiazole-4-carboxamide |
| SMILES (Canonical) | CN1C=C(C2=C1C(=O)C=C(C2=O)N)C3=NC(=CS3)C(=O)N |
| SMILES (Isomeric) | CN1C=C(C2=C1C(=O)C=C(C2=O)N)C3=NC(=CS3)C(=O)N |
| InChI | InChI=1S/C13H10N4O3S/c1-17-3-5(13-16-7(4-21-13)12(15)20)9-10(17)8(18)2-6(14)11(9)19/h2-4H,14H2,1H3,(H2,15,20) |
| InChI Key | ZLMULFPSOBULMS-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C13H10N4O3S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.04736137 g/mol |
| Topological Polar Surface Area (TPSA) | 149.00 Ų |
| XlogP | 0.00 |
| 135261-89-1 |
| BE 10988 |
| 9B0RYT97P7 |
| DTXSID90159293 |
| 4-Thiazolecarboxamide, 2-(5-amino-4,7-dihydro-1-methyl-4,7-dioxo-1H-indol-3-yl)- |
| RefChem:916780 |
| DTXCID3081784 |
| 2-(5-amino-1-methyl-4,7-dioxoindol-3-yl)-1,3-thiazole-4-carboxamide |
| CHEMBL8740 |
| UNII-9B0RYT97P7 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.33% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.18% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.34% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.56% | 95.56% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 89.62% | 94.42% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 89.11% | 93.03% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 87.46% | 96.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.85% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.96% | 90.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.68% | 93.65% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.67% | 92.68% |
| CHEMBL4506 | Q96EB6 | NAD-dependent deacetylase sirtuin 1 | 83.64% | 88.33% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 81.81% | 80.71% |
| CHEMBL3835 | P51955 | Serine/threonine-protein kinase NEK2 | 81.67% | 80.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.74% | 94.00% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 80.45% | 87.67% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.23% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 126200 |
| LOTUS | LTS0088941 |
| wikiData | Q83027598 |